CAS 954328-84-8 is the registry number for 2,3-Dimethyl-5-(1h-tetrazol-1-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2,3-dimethyl-5-(tetrazol-1-yl)aniline (CAS 954328-84-8) is a chemical compound with the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. IUPAC name: 2,3-dimethyl-5-(tetrazol-1-yl)aniline. InChIKey: SQWVCPXNTJGIFG-UHFFFAOYSA-N.
| Molecular formula | C9H11N5 |
|---|---|
| Molecular weight | 189.22 g/mol |
| IUPAC name | 2,3-dimethyl-5-(tetrazol-1-yl)aniline |
| InChIKey | SQWVCPXNTJGIFG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)N)N2C=NN=N2 |
Computed by PubChem (NCBI)