CAS 215190-23-1 appears in our catalog under these names: (R)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–5–phenylpent–4–enoic acid, Fmoc-D-Styryl-Ala-OH 96%, FMOC-D-STYRYLALANINE, 96%, 96%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-phenylpent-4-enoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
(E,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpent-4-enoic acid (CAS 215190-23-1) is a chemical compound with the molecular formula C26H23NO4 and a molecular weight of 413.5 g/mol. IUPAC name: (E,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpent-4-enoic acid. InChIKey: ZFMHHKMOLFNMMV-NOENIZQJSA-N.
| Molecular formula | C26H23NO4 |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | (E,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpent-4-enoic acid |
| InChIKey | ZFMHHKMOLFNMMV-NOENIZQJSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)