Products 2152673-21-5
CAS 2152673-21-5 is the registry number for 1-(4-Bromophenyl)-3-azabicyclo[3.1.1]heptane-2,4-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
1-(4-bromophenyl)-3-azabicyclo[3.1.1]heptane-2,4-dione (CAS 2152673-21-5) is a chemical compound with the molecular formula C12H10BrNO2 and a molecular weight of 280.12 g/mol. IUPAC name: 1-(4-bromophenyl)-3-azabicyclo[3.1.1]heptane-2,4-dione. InChIKey: MOYZTTJFRQPKQB-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2 |
|---|---|
| Molecular weight | 280.12 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3-azabicyclo[3.1.1]heptane-2,4-dione |
| InChIKey | MOYZTTJFRQPKQB-UHFFFAOYSA-N |
| SMILES | C1C2CC1(C(=O)NC2=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)