CAS 21531-46-4 appears in our catalog under these names: (S)-3-Oxocyclohexane-1-carboxylic acid 95%, (S)-3-Oxocyclohexane-1-carboxylic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
(1S)-3-oxocyclohexane-1-carboxylic acid (CAS 21531-46-4) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: (1S)-3-oxocyclohexane-1-carboxylic acid. InChIKey: WATQNARHYZXAGY-YFKPBYRVSA-N.
| Molecular formula | C7H10O3 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | (1S)-3-oxocyclohexane-1-carboxylic acid |
| InChIKey | WATQNARHYZXAGY-YFKPBYRVSA-N |
| SMILES | C1C[C@@H](CC(=O)C1)C(=O)O |
Computed by PubChem (NCBI)