Products 2153239-12-2
CAS 2153239-12-2 is the registry number for rac-1-((2R,3R)-2-(1H-1,2,4-Triazol-5-yl)oxolan-3-yl)methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(2R,3R)-2-(1H-1,2,4-triazol-5-yl)oxolan-3-yl]methanamine (CAS 2153239-12-2) is a chemical compound with the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. IUPAC name: [(2R,3R)-2-(1H-1,2,4-triazol-5-yl)oxolan-3-yl]methanamine. InChIKey: DAAHHUCXQMAPHX-PHDIDXHHSA-N.
| Molecular formula | C7H12N4O |
|---|---|
| Molecular weight | 168.20 g/mol |
| IUPAC name | [(2R,3R)-2-(1H-1,2,4-triazol-5-yl)oxolan-3-yl]methanamine |
| InChIKey | DAAHHUCXQMAPHX-PHDIDXHHSA-N |
| SMILES | C1CO[C@H]([C@H]1CN)C2=NC=NN2 |
Computed by PubChem (NCBI)