CAS 215362-48-4 is the registry number for (R)-7-Methoxy-2,3-dihydro-1H-inden-1-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-7-methoxy-2,3-dihydro-1H-inden-1-amine (CAS 215362-48-4) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: (1R)-7-methoxy-2,3-dihydro-1H-inden-1-amine. InChIKey: RWAJCHDFYSLZND-MRVPVSSYSA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | (1R)-7-methoxy-2,3-dihydro-1H-inden-1-amine |
| InChIKey | RWAJCHDFYSLZND-MRVPVSSYSA-N |
| SMILES | COC1=CC=CC2=C1[C@@H](CC2)N |
Computed by PubChem (NCBI)