CAS 215434-25-6 appears in our catalog under these names: 5-(2-Methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride, 95%, 5-(2-Methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride, 95% , 5-(2-Methylthiazol-4-yl)thiophene-2-sulfonyl chloride, 5-(2-Methylthiazol-4-yl)thiophene-2-sulfonylchloride, 95%. Offered by: Combi-blocks, Thermo Scientific, Biosynth, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 2,5g, 10g.
5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride (CAS 215434-25-6) is a chemical compound with the molecular formula C8H6ClNO2S3 and a molecular weight of 279.8 g/mol. IUPAC name: 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride. InChIKey: YIKNRCVJBOLZFL-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S3 |
|---|---|
| Molecular weight | 279.8 g/mol |
| IUPAC name | 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride |
| InChIKey | YIKNRCVJBOLZFL-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(S2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)