CAS 77974-78-8 appears in our catalog under these names: 2-(Methylthio)benzo[d]thiazole-6-sulfonyl chloride, 98%, 98%, 2-(METHYLTHIO)BENZO[D]THIAZOLE-6-SULFONYL CHLORIDE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
2-methylsulfanyl-1,3-benzothiazole-6-sulfonyl chloride (CAS 77974-78-8) is a chemical compound with the molecular formula C8H6ClNO2S3 and a molecular weight of 279.8 g/mol. IUPAC name: 2-methylsulfanyl-1,3-benzothiazole-6-sulfonyl chloride. InChIKey: HHORWURJUWGIOZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S3 |
|---|---|
| Molecular weight | 279.8 g/mol |
| IUPAC name | 2-methylsulfanyl-1,3-benzothiazole-6-sulfonyl chloride |
| InChIKey | HHORWURJUWGIOZ-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(S1)C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)