CAS 215528-79-3 appears in our catalog under these names: magnesium (2S)–2–aminobutanedioate tetrahydrate, DL-Aspartic acid magnesium salt tetrahydrate, 98.00%, DL-Aspartic acid magnesium salt, magnesium(2+) 2-aminobutanedioate. Offered by: GLPBio, Chemat, Biosynth. Available pack sizes: 100g, 25g, 250g, 50g, 0,25kg, 0,1kg, 5g.
Magnesium 2-aminobutanedioate (CAS 215528-79-3) is a chemical compound with the molecular formula C4H5MgNO4 and a molecular weight of 155.39 g/mol. IUPAC name: magnesium 2-aminobutanedioate. InChIKey: NFFJLMKHRCXLJO-UHFFFAOYSA-L.
| Molecular formula | C4H5MgNO4 |
|---|---|
| Molecular weight | 155.39 g/mol |
| IUPAC name | magnesium 2-aminobutanedioate |
| InChIKey | NFFJLMKHRCXLJO-UHFFFAOYSA-L |
| SMILES | C(C(C(=O)[O-])N)C(=O)[O-].[Mg+2] |
Computed by PubChem (NCBI)