CAS 2155840-15-4 appears in our catalog under these names: tert-Butyl (S)-2-(aminomethyl)-4,4-dimethylpyrrolidine-1-carboxylate, 98%, tert-Butyl (2S)-2-(aminomethyl)-4,4-dimethylpyrrolidine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
Tert-butyl (2S)-2-(aminomethyl)-4,4-dimethylpyrrolidine-1-carboxylate (CAS 2155840-15-4) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl (2S)-2-(aminomethyl)-4,4-dimethylpyrrolidine-1-carboxylate. InChIKey: MOJAUSWMTZEJEX-VIFPVBQESA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl (2S)-2-(aminomethyl)-4,4-dimethylpyrrolidine-1-carboxylate |
| InChIKey | MOJAUSWMTZEJEX-VIFPVBQESA-N |
| SMILES | CC1(C[C@H](N(C1)C(=O)OC(C)(C)C)CN)C |
Computed by PubChem (NCBI)