Products 2639624-59-0
CAS 2639624-59-0 is the registry number for tert-butyl (2R)-2-(aminomethyl)-4,4-dimethyl-pyrrolidine-1-carboxylate. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (2R)-2-(aminomethyl)-4,4-dimethylpyrrolidine-1-carboxylate (CAS 2639624-59-0) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl (2R)-2-(aminomethyl)-4,4-dimethylpyrrolidine-1-carboxylate. InChIKey: MOJAUSWMTZEJEX-SECBINFHSA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl (2R)-2-(aminomethyl)-4,4-dimethylpyrrolidine-1-carboxylate |
| InChIKey | MOJAUSWMTZEJEX-SECBINFHSA-N |
| SMILES | CC1(C[C@@H](N(C1)C(=O)OC(C)(C)C)CN)C |
Computed by PubChem (NCBI)