CAS 2155840-17-6 appears in our catalog under these names: tert-Butyl (((2S,4R)-4-methoxypyrrolidin-2-yl)methyl)carbamate, 98%, tert-Butyl N-{((2S,4R)-4-methoxypyrrolidin-2-yl)methyl}carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
Tert-butyl N-[[(2S,4R)-4-methoxypyrrolidin-2-yl]methyl]carbamate (CAS 2155840-17-6) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl N-[[(2S,4R)-4-methoxypyrrolidin-2-yl]methyl]carbamate. InChIKey: UZCQJAUQLJDJRV-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl N-[[(2S,4R)-4-methoxypyrrolidin-2-yl]methyl]carbamate |
| InChIKey | UZCQJAUQLJDJRV-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1C[C@H](CN1)OC |
Computed by PubChem (NCBI)