Products 2155852-15-4

CAS 2155852-15-4 is the registry number for 4-Methyl-5-oxopiperazine-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

4-methyl-5-oxopiperazine-2-carboxylic acid;hydrochloride (CAS 2155852-15-4) is a chemical compound with the molecular formula C6H11ClN2O3 and a molecular weight of 194.61 g/mol. IUPAC name: 4-methyl-5-oxopiperazine-2-carboxylic acid;hydrochloride. InChIKey: VMEFFBTWFJBCJK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClN2O3
Molecular weight194.61 g/mol
IUPAC name4-methyl-5-oxopiperazine-2-carboxylic acid;hydrochloride
InChIKeyVMEFFBTWFJBCJK-UHFFFAOYSA-N
SMILESCN1CC(NCC1=O)C(=O)O.Cl

Computed by PubChem (NCBI)