CAS 2550997-05-0 is the registry number for Methyl (R)-6-oxopiperazine-2-carboxylate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl (2R)-6-oxopiperazine-2-carboxylate;hydrochloride (CAS 2550997-05-0) is a chemical compound with the molecular formula C6H11ClN2O3 and a molecular weight of 194.61 g/mol. IUPAC name: methyl (2R)-6-oxopiperazine-2-carboxylate;hydrochloride. InChIKey: UOWBLXVFSPXLAC-PGMHMLKASA-N.
| Molecular formula | C6H11ClN2O3 |
|---|---|
| Molecular weight | 194.61 g/mol |
| IUPAC name | methyl (2R)-6-oxopiperazine-2-carboxylate;hydrochloride |
| InChIKey | UOWBLXVFSPXLAC-PGMHMLKASA-N |
| SMILES | COC(=O)[C@H]1CNCC(=O)N1.Cl |
Computed by PubChem (NCBI)