Products 2155856-53-2

CAS 2155856-53-2 is the registry number for 1,5λâ¶,2-Oxathiazepane-5,5-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1,5,2-oxathiazepane 5,5-dioxide;hydrochloride (CAS 2155856-53-2) is a chemical compound with the molecular formula C4H10ClNO3S and a molecular weight of 187.65 g/mol. IUPAC name: 1,5,2-oxathiazepane 5,5-dioxide;hydrochloride. InChIKey: TVLUVTCQAMRHPC-UHFFFAOYSA-N.

Identity
Molecular formulaC4H10ClNO3S
Molecular weight187.65 g/mol
IUPAC name1,5,2-oxathiazepane 5,5-dioxide;hydrochloride
InChIKeyTVLUVTCQAMRHPC-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCON1.Cl

Computed by PubChem (NCBI)