Products 355849-72-8

CAS 355849-72-8 is the registry number for N-(2-Methoxyethyl)-N-methylsulfamoyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

N-(2-methoxyethyl)-N-methylsulfamoyl chloride (CAS 355849-72-8) is a chemical compound with the molecular formula C4H10ClNO3S and a molecular weight of 187.65 g/mol. IUPAC name: N-(2-methoxyethyl)-N-methylsulfamoyl chloride. InChIKey: WQEWZLQWJAZGAW-UHFFFAOYSA-N.

Identity
Molecular formulaC4H10ClNO3S
Molecular weight187.65 g/mol
IUPAC nameN-(2-methoxyethyl)-N-methylsulfamoyl chloride
InChIKeyWQEWZLQWJAZGAW-UHFFFAOYSA-N
SMILESCN(CCOC)S(=O)(=O)Cl

Computed by PubChem (NCBI)