CAS 2155875-72-0 appears in our catalog under these names: 6,8-Dibromo-5-methyl-(1,2,4)triazolo(1,5-a)pyridine, 98%, 6,8-Dibromo-5-methyl-[1,2,4]triazolo[1,5-a]pyridine, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
6,8-dibromo-5-methyl-[1,2,4]triazolo[1,5-a]pyridine (CAS 2155875-72-0) is a chemical compound with the molecular formula C7H5Br2N3 and a molecular weight of 290.94 g/mol. IUPAC name: 6,8-dibromo-5-methyl-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: BWZGUCJBHVFTSL-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2N3 |
|---|---|
| Molecular weight | 290.94 g/mol |
| IUPAC name | 6,8-dibromo-5-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | BWZGUCJBHVFTSL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C2=NC=NN12)Br)Br |
Computed by PubChem (NCBI)