CAS 2380036-95-1 is the registry number for 1-Allyl-3,5-dibromo-1H-pyrazole-4-carbonitrile, 98% +(stabilized with TBC). Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dibromo-1-prop-2-enylpyrazole-4-carbonitrile (CAS 2380036-95-1) is a chemical compound with the molecular formula C7H5Br2N3 and a molecular weight of 290.94 g/mol. IUPAC name: 3,5-dibromo-1-prop-2-enylpyrazole-4-carbonitrile. InChIKey: DMEBWIODCDFUBI-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2N3 |
|---|---|
| Molecular weight | 290.94 g/mol |
| IUPAC name | 3,5-dibromo-1-prop-2-enylpyrazole-4-carbonitrile |
| InChIKey | DMEBWIODCDFUBI-UHFFFAOYSA-N |
| SMILES | C=CCN1C(=C(C(=N1)Br)C#N)Br |
Computed by PubChem (NCBI)