Products 2156651-21-5
CAS 2156651-21-5 appears in our catalog under these names: 2-Bromo-3-(bromomethyl)-1,1'-biphenyl, 98%, 98%, 2-Bromo-3-(bromomethyl)-1,1'-biphenyl, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-1-(bromomethyl)-3-phenylbenzene (CAS 2156651-21-5) is a chemical compound with the molecular formula C13H10Br2 and a molecular weight of 326.03 g/mol. IUPAC name: 2-bromo-1-(bromomethyl)-3-phenylbenzene. InChIKey: PJXZIEDLTHQYBC-UHFFFAOYSA-N.
| Molecular formula | C13H10Br2 |
|---|---|
| Molecular weight | 326.03 g/mol |
| IUPAC name | 2-bromo-1-(bromomethyl)-3-phenylbenzene |
| InChIKey | PJXZIEDLTHQYBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2Br)CBr |
Computed by PubChem (NCBI)