CAS 50670-57-0 appears in our catalog under these names: 4'-Bromo-4-bromomethyl-biphenyl, 95%, 4–Bromo–4'–(bromomethyl)–1,1'–biphenyl, 4-Bromo-4'-(bromomethyl)-1,1'-biphenyl 97%, 4-Bromo-4'-(bromomethyl)-1,1'-biphenyl, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-bromo-4-[4-(bromomethyl)phenyl]benzene (CAS 50670-57-0) is a chemical compound with the molecular formula C13H10Br2 and a molecular weight of 326.03 g/mol. IUPAC name: 1-bromo-4-[4-(bromomethyl)phenyl]benzene. InChIKey: AJHADXHEAFCOTE-UHFFFAOYSA-N.
| Molecular formula | C13H10Br2 |
|---|---|
| Molecular weight | 326.03 g/mol |
| IUPAC name | 1-bromo-4-[4-(bromomethyl)phenyl]benzene |
| InChIKey | AJHADXHEAFCOTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)