Products 2158298-54-3
CAS 2158298-54-3 is the registry number for 2-bromo-3-fluoro-1-(methoxymethoxy)-4-methylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg.
2-bromo-3-fluoro-1-(methoxymethoxy)-4-methylbenzene (CAS 2158298-54-3) is a chemical compound with the molecular formula C9H10BrFO2 and a molecular weight of 249.08 g/mol. IUPAC name: 2-bromo-3-fluoro-1-(methoxymethoxy)-4-methylbenzene. InChIKey: TYZCBROTRYSTPT-UHFFFAOYSA-N.
| Molecular formula | C9H10BrFO2 |
|---|---|
| Molecular weight | 249.08 g/mol |
| IUPAC name | 2-bromo-3-fluoro-1-(methoxymethoxy)-4-methylbenzene |
| InChIKey | TYZCBROTRYSTPT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)OCOC)Br)F |
Computed by PubChem (NCBI)