CAS 215870-99-8 is the registry number for 1,4-Dichloro-5,8-difluorophthalazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dichloro-5,8-difluorophthalazine (CAS 215870-99-8) is a chemical compound with the molecular formula C8H2Cl2F2N2 and a molecular weight of 235.01 g/mol. IUPAC name: 1,4-dichloro-5,8-difluorophthalazine. InChIKey: YZZUMWCERRAQPC-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2F2N2 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 1,4-dichloro-5,8-difluorophthalazine |
| InChIKey | YZZUMWCERRAQPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)C(=NN=C2Cl)Cl)F |
Computed by PubChem (NCBI)