CAS 2205403-97-8 is the registry number for 2,4-Dichloro-5,6-difluoroquinazoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-5,6-difluoroquinazoline (CAS 2205403-97-8) is a chemical compound with the molecular formula C8H2Cl2F2N2 and a molecular weight of 235.01 g/mol. IUPAC name: 2,4-dichloro-5,6-difluoroquinazoline. InChIKey: XBFBIETUWMHQPB-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2F2N2 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 2,4-dichloro-5,6-difluoroquinazoline |
| InChIKey | XBFBIETUWMHQPB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1N=C(N=C2Cl)Cl)F)F |
Computed by PubChem (NCBI)