CAS 215928-54-4 is the registry number for 5-(2-Thienyl)thieno[2,3-d]pyrimidin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 215928-54-4) is a chemical compound with the molecular formula C10H6N2OS2 and a molecular weight of 234.3 g/mol. IUPAC name: 5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: LFUBTAOTPHKKOS-UHFFFAOYSA-N.
| Molecular formula | C10H6N2OS2 |
|---|---|
| Molecular weight | 234.3 g/mol |
| IUPAC name | 5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | LFUBTAOTPHKKOS-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CSC3=C2C(=O)NC=N3 |
Computed by PubChem (NCBI)