CAS 24447-14-1 appears in our catalog under these names: 2,5-Di(thiophen-2-yl)-1,3,4-oxadiazole, 95%, 2,5–Dithiophen–2–yl–1,3,4–oxadiazole, 1,3,4-OXadiazole, 2,5-di-2-thienyl- 95%, 2,5-di(2-thienyl)-1,3,4-oxadiazole, 95%, 95%, 2,5-Dithiophen-2-yl-1,3,4-oxadiazole, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg.
2,5-dithiophen-2-yl-1,3,4-oxadiazole (CAS 24447-14-1) is a chemical compound with the molecular formula C10H6N2OS2 and a molecular weight of 234.3 g/mol. IUPAC name: 2,5-dithiophen-2-yl-1,3,4-oxadiazole. InChIKey: NSEQPFDDIHMPDU-UHFFFAOYSA-N.
| Molecular formula | C10H6N2OS2 |
|---|---|
| Molecular weight | 234.3 g/mol |
| IUPAC name | 2,5-dithiophen-2-yl-1,3,4-oxadiazole |
| InChIKey | NSEQPFDDIHMPDU-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NN=C(O2)C3=CC=CS3 |
Computed by PubChem (NCBI)