CAS 216063-62-6 is the registry number for (S)-1-Benzyl-4-(benzyloxy)pyrrolidin-2-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(4S)-1-benzyl-4-phenylmethoxypyrrolidin-2-one (CAS 216063-62-6) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: (4S)-1-benzyl-4-phenylmethoxypyrrolidin-2-one. InChIKey: DECCHABSYSOJSZ-KRWDZBQOSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | (4S)-1-benzyl-4-phenylmethoxypyrrolidin-2-one |
| InChIKey | DECCHABSYSOJSZ-KRWDZBQOSA-N |
| SMILES | C1[C@@H](CN(C1=O)CC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)