Products 2162117-49-7
CAS 2162117-49-7 is the registry number for rel-Methyl (3aR,6aR)-tetrahydro-5-(phenylmethyl)-1H-furo[3,4-c]pyrrole-3a(6aH)-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl (3aS,6aS)-5-benzyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate (CAS 2162117-49-7) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: methyl (3aS,6aS)-5-benzyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate. InChIKey: AIRPGVWUISBARE-ZFWWWQNUSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | methyl (3aS,6aS)-5-benzyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate |
| InChIKey | AIRPGVWUISBARE-ZFWWWQNUSA-N |
| SMILES | COC(=O)[C@]12CN(C[C@H]1COC2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)