CAS 2163052-04-6 appears in our catalog under these names: 2,5–Di(1H–1,2,4–triazol–1–yl)terephthalic acid, 2,5-Di(1H-1,2,4-triazol-1-yl)terephthalic acid, 95%, 2,5-Di(1H-1,2,4-triazol-1-yl)terephthalic acid, 98%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
2,5-bis(1,2,4-triazol-1-yl)terephthalic acid (CAS 2163052-04-6) is a chemical compound with the molecular formula C12H8N6O4 and a molecular weight of 300.23 g/mol. IUPAC name: 2,5-bis(1,2,4-triazol-1-yl)terephthalic acid. InChIKey: RWLIKKYPSHXLNR-UHFFFAOYSA-N.
| Molecular formula | C12H8N6O4 |
|---|---|
| Molecular weight | 300.23 g/mol |
| IUPAC name | 2,5-bis(1,2,4-triazol-1-yl)terephthalic acid |
| InChIKey | RWLIKKYPSHXLNR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N2C=NC=N2)C(=O)O)N3C=NC=N3)C(=O)O |
Computed by PubChem (NCBI)