CAS 2227468-63-3 appears in our catalog under these names: 4,6–Di(1H–1,2,4–triazol–1–yl)isophthalic acid, 4,6-Di(1H-1,2,4-triazol-1-yl)isophthalic acid, 98%, 98%, 4,6-Di(1H-1,2,4-triazol-1-yl)isophthalic acid, 98%, 4,6-Di(1H-1,2,4-triazol-1-yl)isophthalic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
4,6-bis(1,2,4-triazol-1-yl)benzene-1,3-dicarboxylic acid (CAS 2227468-63-3) is a chemical compound with the molecular formula C12H8N6O4 and a molecular weight of 300.23 g/mol. IUPAC name: 4,6-bis(1,2,4-triazol-1-yl)benzene-1,3-dicarboxylic acid. InChIKey: AJGSSDYXGGRSOA-UHFFFAOYSA-N.
| Molecular formula | C12H8N6O4 |
|---|---|
| Molecular weight | 300.23 g/mol |
| IUPAC name | 4,6-bis(1,2,4-triazol-1-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | AJGSSDYXGGRSOA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C(=O)O)N2C=NC=N2)N3C=NC=N3)C(=O)O |
Computed by PubChem (NCBI)