CAS 2165517-36-0 is the registry number for tert-Butyl (3R)-3-amino-3-(hydroxymethyl)piperidine-1-carboxylate, 94%, 94%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
Tert-butyl (3R)-3-amino-3-(hydroxymethyl)piperidine-1-carboxylate (CAS 2165517-36-0) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl (3R)-3-amino-3-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: YWAHTVBAPQTWIP-LLVKDONJSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl (3R)-3-amino-3-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | YWAHTVBAPQTWIP-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@](C1)(CO)N |
Computed by PubChem (NCBI)