Products 2165711-41-9

CAS 2165711-41-9 is the registry number for Trans 3-ethanesulfonylamino-cyclohexanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Trans-(1R,3R)-3-(ethylsulfonylamino)cyclohexane-1-carboxylic acid (CAS 2165711-41-9) is a chemical compound with the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. IUPAC name: trans-(1R,3R)-3-(ethylsulfonylamino)cyclohexane-1-carboxylic acid. InChIKey: HVQSVUZNDRLMJX-HTQZYQBOSA-N.

Identity
Molecular formulaC9H17NO4S
Molecular weight235.30 g/mol
IUPAC nametrans-(1R,3R)-3-(ethylsulfonylamino)cyclohexane-1-carboxylic acid
InChIKeyHVQSVUZNDRLMJX-HTQZYQBOSA-N
SMILESCCS(=O)(=O)N[C@@H]1CCC[C@H](C1)C(=O)O

Computed by PubChem (NCBI)