CAS 477858-29-0 appears in our catalog under these names: 2-(1,1-Dioxo-1lambda(6),4-thiazinan-4-yl)-3-methylbutanoic acid, 95%, 2-(1,1-Dioxidothiomorpholin-4-yl)-3-methylbutanoic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylbutanoic acid (CAS 477858-29-0) is a chemical compound with the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. IUPAC name: 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylbutanoic acid. InChIKey: PFROBWBWLBKUAR-UHFFFAOYSA-N.
| Molecular formula | C9H17NO4S |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-methylbutanoic acid |
| InChIKey | PFROBWBWLBKUAR-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)N1CCS(=O)(=O)CC1 |
Computed by PubChem (NCBI)