Products 2165723-51-1
CAS 2165723-51-1 is the registry number for tert-Butyl (R)-3-(oxazol-4-yl)piperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R)-3-(1,3-oxazol-4-yl)piperazine-1-carboxylate (CAS 2165723-51-1) is a chemical compound with the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. IUPAC name: tert-butyl (3R)-3-(1,3-oxazol-4-yl)piperazine-1-carboxylate. InChIKey: LXDHLQKTKMBCSH-SECBINFHSA-N.
| Molecular formula | C12H19N3O3 |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | tert-butyl (3R)-3-(1,3-oxazol-4-yl)piperazine-1-carboxylate |
| InChIKey | LXDHLQKTKMBCSH-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@H](C1)C2=COC=N2 |
Computed by PubChem (NCBI)