CAS 2165939-46-6 is the registry number for tert-butyl (1S,4R,5R)-5-(hydroxymethyl)-2-azabicyclo(2.2.1)heptane-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
Tert-butyl (1S,4R,5R)-5-(hydroxymethyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 2165939-46-6) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl (1S,4R,5R)-5-(hydroxymethyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: FZSNTGVWRIIJNL-GUBZILKMSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl (1S,4R,5R)-5-(hydroxymethyl)-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | FZSNTGVWRIIJNL-GUBZILKMSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@H]1C[C@H]2CO |
Computed by PubChem (NCBI)