CAS 2166001-50-7 is the registry number for 4-Ethyl-3-((2S,4S)-4-methoxypyrrolidin-2-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-ethyl-3-[(2S,4S)-4-methoxypyrrolidin-2-yl]-1H-1,2,4-triazol-5-one (CAS 2166001-50-7) is a chemical compound with the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. IUPAC name: 4-ethyl-3-[(2S,4S)-4-methoxypyrrolidin-2-yl]-1H-1,2,4-triazol-5-one. InChIKey: PITYXIRPYRANTN-BQBZGAKWSA-N.
| Molecular formula | C9H16N4O2 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | 4-ethyl-3-[(2S,4S)-4-methoxypyrrolidin-2-yl]-1H-1,2,4-triazol-5-one |
| InChIKey | PITYXIRPYRANTN-BQBZGAKWSA-N |
| SMILES | CCN1C(=NNC1=O)[C@@H]2C[C@@H](CN2)OC |
Computed by PubChem (NCBI)