CAS 78033-18-8 appears in our catalog under these names: 4,5-Diamino-3-isobutyl-1-methylpyrimidine-2,6-dione, 98%, 4,5-Diamino-3-isobutyl-1-methylpyrimidine-2,6-dione, 4,5-Diamino-3-Isobutyl-1-Methylpyrimidine-2,6-Dione, 95%, 95%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 1g, 100mg, 250mg.
5,6-diamino-3-methyl-1-(2-methylpropyl)pyrimidine-2,4-dione (CAS 78033-18-8) is a chemical compound with the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. IUPAC name: 5,6-diamino-3-methyl-1-(2-methylpropyl)pyrimidine-2,4-dione. InChIKey: VULNACCPMCVPGE-UHFFFAOYSA-N.
| Molecular formula | C9H16N4O2 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | 5,6-diamino-3-methyl-1-(2-methylpropyl)pyrimidine-2,4-dione |
| InChIKey | VULNACCPMCVPGE-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C(=C(C(=O)N(C1=O)C)N)N |
Computed by PubChem (NCBI)