Products 2166021-87-8
CAS 2166021-87-8 is the registry number for tert-butyl N-[cis-5-amino-3,3-difluorocyclohexyl]carbamate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl N-[(1S,5R)-5-amino-3,3-difluorocyclohexyl]carbamate (CAS 2166021-87-8) is a chemical compound with the molecular formula C11H20F2N2O2 and a molecular weight of 250.29 g/mol. IUPAC name: tert-butyl N-[(1S,5R)-5-amino-3,3-difluorocyclohexyl]carbamate. InChIKey: SQCWSHBAIPRRPJ-SFYZADRCSA-N.
| Molecular formula | C11H20F2N2O2 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | tert-butyl N-[(1S,5R)-5-amino-3,3-difluorocyclohexyl]carbamate |
| InChIKey | SQCWSHBAIPRRPJ-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H](CC(C1)(F)F)N |
Computed by PubChem (NCBI)