CAS 2166323-71-1 is the registry number for trans-3-isopropenylcyclohexanol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (1S,4S)-7-hydroxy-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (CAS 2166323-71-1) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: tert-butyl (1S,4S)-7-hydroxy-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: BETGJOXYTQTEPO-WPZUCAASSA-N.
| Molecular formula | C10H18N2O3 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | tert-butyl (1S,4S)-7-hydroxy-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | BETGJOXYTQTEPO-WPZUCAASSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C([C@@H]1CN2)O |
Computed by PubChem (NCBI)