Products 2166648-02-6
CAS 2166648-02-6 is the registry number for 7-Bromo-2-chloroquinolin-4-ol, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 50mg.
7-bromo-2-chloro-1H-quinolin-4-one (CAS 2166648-02-6) is a chemical compound with the molecular formula C9H5BrClNO and a molecular weight of 258.50 g/mol. IUPAC name: 7-bromo-2-chloro-1H-quinolin-4-one. InChIKey: ROCRVYVCHVKALR-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 7-bromo-2-chloro-1H-quinolin-4-one |
| InChIKey | ROCRVYVCHVKALR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC(=CC2=O)Cl |
Computed by PubChem (NCBI)