CAS 2166675-70-1 is the registry number for 5-Bromo-8-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-8-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (CAS 2166675-70-1) is a chemical compound with the molecular formula C10H9BrFNO2 and a molecular weight of 274.09 g/mol. IUPAC name: 5-bromo-8-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid. InChIKey: NLIJMONHKRVNJS-UHFFFAOYSA-N.
| Molecular formula | C10H9BrFNO2 |
|---|---|
| Molecular weight | 274.09 g/mol |
| IUPAC name | 5-bromo-8-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
| InChIKey | NLIJMONHKRVNJS-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C=CC(=C2C1C(=O)O)Br)F |
Computed by PubChem (NCBI)