CAS 688363-74-8 is the registry number for 8-Bromo-6-fluoro-2,2-dimethyl-4H-1,4-benzoxazin-3-one, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
8-bromo-6-fluoro-2,2-dimethyl-4H-1,4-benzoxazin-3-one (CAS 688363-74-8) is a chemical compound with the molecular formula C10H9BrFNO2 and a molecular weight of 274.09 g/mol. IUPAC name: 8-bromo-6-fluoro-2,2-dimethyl-4H-1,4-benzoxazin-3-one. InChIKey: LPEKDSIHOMODMZ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrFNO2 |
|---|---|
| Molecular weight | 274.09 g/mol |
| IUPAC name | 8-bromo-6-fluoro-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| InChIKey | LPEKDSIHOMODMZ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C(=CC(=C2)F)Br)C |
Computed by PubChem (NCBI)