CAS 21668-34-8 appears in our catalog under these names: 3,5-Dimethyl-4-methoxybenzoyl chloride, 95%, 3,5-Dimethyl-4-methoxybenzoyl chloride, 98%, 3,5-DIMETHYL-4-METHOXYBENZOYL CHLORIDE, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg.
4-methoxy-3,5-dimethylbenzoyl chloride (CAS 21668-34-8) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 4-methoxy-3,5-dimethylbenzoyl chloride. InChIKey: NVSLDNSTGOKOJF-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 4-methoxy-3,5-dimethylbenzoyl chloride |
| InChIKey | NVSLDNSTGOKOJF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC)C)C(=O)Cl |
Computed by PubChem (NCBI)