Products 2166865-82-1

CAS 2166865-82-1 is the registry number for Methyl 3-bromo-1-(methoxymethyl)-1h-1,2,4-triazole-5-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 5-bromo-2-(methoxymethyl)-1,2,4-triazole-3-carboxylate (CAS 2166865-82-1) is a chemical compound with the molecular formula C6H8BrN3O3 and a molecular weight of 250.05 g/mol. IUPAC name: methyl 5-bromo-2-(methoxymethyl)-1,2,4-triazole-3-carboxylate. InChIKey: AJGJLJZUIIGEDX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8BrN3O3
Molecular weight250.05 g/mol
IUPAC namemethyl 5-bromo-2-(methoxymethyl)-1,2,4-triazole-3-carboxylate
InChIKeyAJGJLJZUIIGEDX-UHFFFAOYSA-N
SMILESCOCN1C(=NC(=N1)Br)C(=O)OC

Computed by PubChem (NCBI)