CAS 2166865-82-1 is the registry number for Methyl 3-bromo-1-(methoxymethyl)-1h-1,2,4-triazole-5-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Methyl 5-bromo-2-(methoxymethyl)-1,2,4-triazole-3-carboxylate (CAS 2166865-82-1) is a chemical compound with the molecular formula C6H8BrN3O3 and a molecular weight of 250.05 g/mol. IUPAC name: methyl 5-bromo-2-(methoxymethyl)-1,2,4-triazole-3-carboxylate. InChIKey: AJGJLJZUIIGEDX-UHFFFAOYSA-N.
| Molecular formula | C6H8BrN3O3 |
|---|---|
| Molecular weight | 250.05 g/mol |
| IUPAC name | methyl 5-bromo-2-(methoxymethyl)-1,2,4-triazole-3-carboxylate |
| InChIKey | AJGJLJZUIIGEDX-UHFFFAOYSA-N |
| SMILES | COCN1C(=NC(=N1)Br)C(=O)OC |
Computed by PubChem (NCBI)