Products 2702997-64-4

CAS 2702997-64-4 is the registry number for Ethyl 2-(3-bromo-5-oxo-1,5-dihydro-4H-1,2,4-triazol-4-yl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-(3-bromo-5-oxo-1H-1,2,4-triazol-4-yl)acetate (CAS 2702997-64-4) is a chemical compound with the molecular formula C6H8BrN3O3 and a molecular weight of 250.05 g/mol. IUPAC name: ethyl 2-(3-bromo-5-oxo-1H-1,2,4-triazol-4-yl)acetate. InChIKey: ZXCSCTODMCJOLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8BrN3O3
Molecular weight250.05 g/mol
IUPAC nameethyl 2-(3-bromo-5-oxo-1H-1,2,4-triazol-4-yl)acetate
InChIKeyZXCSCTODMCJOLZ-UHFFFAOYSA-N
SMILESCCOC(=O)CN1C(=O)NN=C1Br

Computed by PubChem (NCBI)