Products 2166910-83-2

CAS 2166910-83-2 is the registry number for 5-Cyanopyridine-2-sulfinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-cyanopyridine-2-sulfinic acid (CAS 2166910-83-2) is a chemical compound with the molecular formula C6H4N2O2S and a molecular weight of 168.18 g/mol. IUPAC name: 5-cyanopyridine-2-sulfinic acid. InChIKey: ADAJGUPJLURGAD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4N2O2S
Molecular weight168.18 g/mol
IUPAC name5-cyanopyridine-2-sulfinic acid
InChIKeyADAJGUPJLURGAD-UHFFFAOYSA-N
SMILESC1=CC(=NC=C1C#N)S(=O)O

Computed by PubChem (NCBI)