CAS 90070-10-3 is the registry number for Thieno[3,4-b]pyrazine-2,3(1H,4H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dihydrothieno[3,4-b]pyrazine-2,3-dione (CAS 90070-10-3) is a chemical compound with the molecular formula C6H4N2O2S and a molecular weight of 168.18 g/mol. IUPAC name: 1,4-dihydrothieno[3,4-b]pyrazine-2,3-dione. InChIKey: SAUUUBBWGLSMPW-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O2S |
|---|---|
| Molecular weight | 168.18 g/mol |
| IUPAC name | 1,4-dihydrothieno[3,4-b]pyrazine-2,3-dione |
| InChIKey | SAUUUBBWGLSMPW-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CS1)NC(=O)C(=O)N2 |
Computed by PubChem (NCBI)