CAS 2167084-96-8 is the registry number for tert-butyl 3-(1-amino-2,2,2-trifluoroethyl)azetidine-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl 3-(1-amino-2,2,2-trifluoroethyl)azetidine-1-carboxylate (CAS 2167084-96-8) is a chemical compound with the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. IUPAC name: tert-butyl 3-(1-amino-2,2,2-trifluoroethyl)azetidine-1-carboxylate. InChIKey: BUNJKYOHGZDZRA-UHFFFAOYSA-N.
| Molecular formula | C10H17F3N2O2 |
|---|---|
| Molecular weight | 254.25 g/mol |
| IUPAC name | tert-butyl 3-(1-amino-2,2,2-trifluoroethyl)azetidine-1-carboxylate |
| InChIKey | BUNJKYOHGZDZRA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C(C(F)(F)F)N |
Computed by PubChem (NCBI)