CAS 1260795-79-6 appears in our catalog under these names: 3-Amino-3-trifluoromethyl-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%, 1-Boc-3-amino-3-(trifluoromethyl)pyrrolidine, 95+%, tert-butyl 3-amino-3-(trifluoromethyl)pyrrolidine-1-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 0,5g, 50mg.
Tert-butyl 3-amino-3-(trifluoromethyl)pyrrolidine-1-carboxylate (CAS 1260795-79-6) is a chemical compound with the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. IUPAC name: tert-butyl 3-amino-3-(trifluoromethyl)pyrrolidine-1-carboxylate. InChIKey: YHPCKIFBYOPVAL-UHFFFAOYSA-N.
| Molecular formula | C10H17F3N2O2 |
|---|---|
| Molecular weight | 254.25 g/mol |
| IUPAC name | tert-butyl 3-amino-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
| InChIKey | YHPCKIFBYOPVAL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)(C(F)(F)F)N |
Computed by PubChem (NCBI)