Products 2167234-97-9
CAS 2167234-97-9 is the registry number for 3-({((tert-Butoxy)carbonyl)amino}methyl)-3-hydroxycyclobutane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-hydroxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclobutane-1-carboxylic acid (CAS 2167234-97-9) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 3-hydroxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclobutane-1-carboxylic acid. InChIKey: HPTXEJJZIZTDON-UHFFFAOYSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 3-hydroxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclobutane-1-carboxylic acid |
| InChIKey | HPTXEJJZIZTDON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CC(C1)C(=O)O)O |
Computed by PubChem (NCBI)