Products 2167447-92-7
CAS 2167447-92-7 is the registry number for 4-chloro-2-methyl-5-(trifluoromethyl)pyridine, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-chloro-2-methyl-5-(trifluoromethyl)pyridine (CAS 2167447-92-7) is a chemical compound with the molecular formula C7H5ClF3N and a molecular weight of 195.57 g/mol. IUPAC name: 4-chloro-2-methyl-5-(trifluoromethyl)pyridine. InChIKey: MIPGZHSGAHRDIP-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3N |
|---|---|
| Molecular weight | 195.57 g/mol |
| IUPAC name | 4-chloro-2-methyl-5-(trifluoromethyl)pyridine |
| InChIKey | MIPGZHSGAHRDIP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=N1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)